C14H24N6O2S — CID 56922206
4-(4-methylpiperazin-1-yl)-6-(4-methylsulfonylpiperazin-1-yl)pyrimidine (PubChem CID 56922206) has the molecular formula C14H24N6O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-6-(4-methylsulfonylpiperazin-1-yl)pyrimidine.
| Compound Name | 4-(4-methylpiperazin-1-yl)-6-(4-methylsulfonylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 56922206 |
| Molecular Formula | C14H24N6O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-6-(4-methylsulfonylpiperazin-1-yl)pyrimidine |
| SMILES | CN1CCN(c2cc(N3CCN(S(C)(=O)=O)CC3)ncn2)CC1 |
| InChI | InChI=1S/C14H24N6O2S/c1-17-3-5-18(6-4-17)13-11-14(16-12-15-13)19-7-9-20(10-8-19)23(2,21)22/h11-12H,3-10H2,1-2H3 |
| InChIKey | OONPMKHNRIFZKF-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |