C14H22N4O2S — CID 165435367
1-(6-cyclobutylpyrimidin-4-yl)-4-methylsulfonyl-1,4-diazepane (PubChem CID 165435367) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 1-(6-cyclobutylpyrimidin-4-yl)-4-methylsulfonyl-1,4-diazepane.
| Compound Name | 1-(6-cyclobutylpyrimidin-4-yl)-4-methylsulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 165435367 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-(6-cyclobutylpyrimidin-4-yl)-4-methylsulfonyl-1,4-diazepane |
| SMILES | CS(=O)(=O)N1CCCN(c2cc(C3CCC3)ncn2)CC1 |
| InChI | InChI=1S/C14H22N4O2S/c1-21(19,20)18-7-3-6-17(8-9-18)14-10-13(15-11-16-14)12-4-2-5-12/h10-12H,2-9H2,1H3 |
| InChIKey | OZJLOVMIPZOWBH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |