C12H17BrN2O2S — CID 2468104
1-(2-bromophenyl)sulfonyl-4-methyl-1,4-diazepane (PubChem CID 2468104) has the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfonyl-4-methyl-1,4-diazepane.
| Compound Name | 1-(2-bromophenyl)sulfonyl-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 2468104 |
| Molecular Formula | C12H17BrN2O2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 1-(2-bromophenyl)sulfonyl-4-methyl-1,4-diazepane |
| SMILES | CN1CCCN(S(=O)(=O)c2ccccc2Br)CC1 |
| InChI | InChI=1S/C12H17BrN2O2S/c1-14-7-4-8-15(10-9-14)18(16,17)12-6-3-2-5-11(12)13/h2-3,5-6H,4,7-10H2,1H3 |
| InChIKey | YECLKOQTKQITMA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |