C19H20FN5O2S — CID 122342117
4-[4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-6-pyrrol-1-ylpyrimidine (PubChem CID 122342117) has the molecular formula C19H20FN5O2S and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-[4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-6-pyrrol-1-ylpyrimidine.
| Compound Name | 4-[4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-6-pyrrol-1-ylpyrimidine |
|---|---|
| PubChem CID | 122342117 |
| Molecular Formula | C19H20FN5O2S |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 4-[4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-6-pyrrol-1-ylpyrimidine |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)N1CCN(c2cc(-n3cccc3)ncn2)CC1 |
| InChI | InChI=1S/C19H20FN5O2S/c20-17-5-3-16(4-6-17)14-28(26,27)25-11-9-24(10-12-25)19-13-18(21-15-22-19)23-7-1-2-8-23/h1-8,13,15H,9-12,14H2 |
| InChIKey | ZMXZBMACHXGPLM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |