C16H19FN4O2S — CID 53006604
4-(4-ethylsulfonylpiperazin-1-yl)-6-(4-fluorophenyl)pyrimidine (PubChem CID 53006604) has the molecular formula C16H19FN4O2S and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-(4-ethylsulfonylpiperazin-1-yl)-6-(4-fluorophenyl)pyrimidine.
| Compound Name | 4-(4-ethylsulfonylpiperazin-1-yl)-6-(4-fluorophenyl)pyrimidine |
|---|---|
| PubChem CID | 53006604 |
| Molecular Formula | C16H19FN4O2S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 4-(4-ethylsulfonylpiperazin-1-yl)-6-(4-fluorophenyl)pyrimidine |
| SMILES | CCS(=O)(=O)N1CCN(c2cc(-c3ccc(F)cc3)ncn2)CC1 |
| InChI | InChI=1S/C16H19FN4O2S/c1-2-24(22,23)21-9-7-20(8-10-21)16-11-15(18-12-19-16)13-3-5-14(17)6-4-13/h3-6,11-12H,2,7-10H2,1H3 |
| InChIKey | OXAUUFIMQWXWRH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |