C18H16ClFN4O2S2 — CID 121107498
4-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-6-(4-fluorophenyl)pyrimidine (PubChem CID 121107498) has the molecular formula C18H16ClFN4O2S2 and a molecular weight of 438.94 g/mol. Its IUPAC name is 4-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-6-(4-fluorophenyl)pyrimidine.
| Compound Name | 4-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-6-(4-fluorophenyl)pyrimidine |
|---|---|
| PubChem CID | 121107498 |
| Molecular Formula | C18H16ClFN4O2S2 |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 4-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-6-(4-fluorophenyl)pyrimidine |
| SMILES | O=S(=O)(c1ccc(Cl)s1)N1CCN(c2cc(-c3ccc(F)cc3)ncn2)CC1 |
| InChI | InChI=1S/C18H16ClFN4O2S2/c19-16-5-6-18(27-16)28(25,26)24-9-7-23(8-10-24)17-11-15(21-12-22-17)13-1-3-14(20)4-2-13/h1-6,11-12H,7-10H2 |
| InChIKey | FSHCCVHWEDWQIZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |