C21H20Cl2N4O2S — CID 90517124
4-[4-(2,4-dichloro-5-methylphenyl)sulfonylpiperazin-1-yl]-6-phenylpyrimidine (PubChem CID 90517124) has the molecular formula C21H20Cl2N4O2S and a molecular weight of 463.39 g/mol. Its IUPAC name is 4-[4-(2,4-dichloro-5-methylphenyl)sulfonylpiperazin-1-yl]-6-phenylpyrimidine.
| Compound Name | 4-[4-(2,4-dichloro-5-methylphenyl)sulfonylpiperazin-1-yl]-6-phenylpyrimidine |
|---|---|
| PubChem CID | 90517124 |
| Molecular Formula | C21H20Cl2N4O2S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 4-[4-(2,4-dichloro-5-methylphenyl)sulfonylpiperazin-1-yl]-6-phenylpyrimidine |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(c3cc(-c4ccccc4)ncn3)CC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H20Cl2N4O2S/c1-15-11-20(18(23)12-17(15)22)30(28,29)27-9-7-26(8-10-27)21-13-19(24-14-25-21)16-5-3-2-4-6-16/h2-6,11-14H,7-10H2,1H3 |
| InChIKey | VHSCJWDMBYITRZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |