C17H18FN5O2S — CID 122308318
1-(4-fluorophenyl)-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]methanesulfonamide (PubChem CID 122308318) has the molecular formula C17H18FN5O2S and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 122308318 |
| Molecular Formula | C17H18FN5O2S |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)NCCNc1cc(-n2cccc2)ncn1 |
| InChI | InChI=1S/C17H18FN5O2S/c18-15-5-3-14(4-6-15)12-26(24,25)22-8-7-19-16-11-17(21-13-20-16)23-9-1-2-10-23/h1-6,9-11,13,22H,7-8,12H2,(H,19,20,21) |
| InChIKey | NBZMFPJLZZERFZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|