C18H22N6O2S — CID 122328463
1-(3-methylphenyl)-N-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide (PubChem CID 122328463) has the molecular formula C18H22N6O2S and a molecular weight of 386.48 g/mol. Its IUPAC name is 1-(3-methylphenyl)-N-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide.
| Compound Name | 1-(3-methylphenyl)-N-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 122328463 |
| Molecular Formula | C18H22N6O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 1-(3-methylphenyl)-N-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
| SMILES | Cc1cccc(CS(=O)(=O)NCCNc2cc(-n3ccc(C)n3)ncn2)c1 |
| InChI | InChI=1S/C18H22N6O2S/c1-14-4-3-5-16(10-14)12-27(25,26)22-8-7-19-17-11-18(21-13-20-17)24-9-6-15(2)23-24/h3-6,9-11,13,22H,7-8,12H2,1-2H3,(H,19,20,21) |
| InChIKey | ISRNLPQSUQHNSM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|