C19H24N6O3S — CID 122328472
4-ethoxy-3-methyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide (PubChem CID 122328472) has the molecular formula C19H24N6O3S and a molecular weight of 416.51 g/mol. Its IUPAC name is 4-ethoxy-3-methyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-ethoxy-3-methyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122328472 |
| Molecular Formula | C19H24N6O3S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4-ethoxy-3-methyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCNc2cc(-n3ccc(C)n3)ncn2)cc1C |
| InChI | InChI=1S/C19H24N6O3S/c1-4-28-17-6-5-16(11-14(17)2)29(26,27)23-9-8-20-18-12-19(22-13-21-18)25-10-7-15(3)24-25/h5-7,10-13,23H,4,8-9H2,1-3H3,(H,20,21,22) |
| InChIKey | HFDZQOZVBPHWAO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|