C18H20F2N6O2S — CID 122328843
1-(2,5-difluorophenyl)-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide (PubChem CID 122328843) has the molecular formula C18H20F2N6O2S and a molecular weight of 422.46 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide.
| Compound Name | 1-(2,5-difluorophenyl)-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 122328843 |
| Molecular Formula | C18H20F2N6O2S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 1-(2,5-difluorophenyl)-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
| SMILES | Cc1ncn(-c2cc(NCCNS(=O)(=O)Cc3cc(F)ccc3F)ncn2)c1C |
| InChI | InChI=1S/C18H20F2N6O2S/c1-12-13(2)26(11-24-12)18-8-17(22-10-23-18)21-5-6-25-29(27,28)9-14-7-15(19)3-4-16(14)20/h3-4,7-8,10-11,25H,5-6,9H2,1-2H3,(H,21,22,23) |
| InChIKey | KZTMQZCFNQVGTB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|