C18H22N6O3S — CID 122328888
N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2-methoxybenzenesulfonamide (PubChem CID 122328888) has the molecular formula C18H22N6O3S and a molecular weight of 402.48 g/mol. Its IUPAC name is N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2-methoxybenzenesulfonamide.
| Compound Name | N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 122328888 |
| Molecular Formula | C18H22N6O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccccc1S(=O)(=O)NCCNc1cc(-n2cnc(C)c2C)ncn1 |
| InChI | InChI=1S/C18H22N6O3S/c1-13-14(2)24(12-22-13)18-10-17(20-11-21-18)19-8-9-23-28(25,26)16-7-5-4-6-15(16)27-3/h4-7,10-12,23H,8-9H2,1-3H3,(H,19,20,21) |
| InChIKey | QYMPYLZYOVHSAX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|