C23H24N6O2S — CID 122328620
N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-4-phenylbenzenesulfonamide (PubChem CID 122328620) has the molecular formula C23H24N6O2S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 122328620 |
| Molecular Formula | C23H24N6O2S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-4-phenylbenzenesulfonamide |
| SMILES | Cc1ncn(-c2cc(NCCNS(=O)(=O)c3ccc(-c4ccccc4)cc3)ncn2)c1C |
| InChI | InChI=1S/C23H24N6O2S/c1-17-18(2)29(16-27-17)23-14-22(25-15-26-23)24-12-13-28-32(30,31)21-10-8-20(9-11-21)19-6-4-3-5-7-19/h3-11,14-16,28H,12-13H2,1-2H3,(H,24,25,26) |
| InChIKey | HNNORERQPFMTND-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|