C19H21FN6O — CID 122328733
N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2-(2-fluorophenyl)acetamide (PubChem CID 122328733) has the molecular formula C19H21FN6O and a molecular weight of 368.42 g/mol. Its IUPAC name is N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 122328733 |
| Molecular Formula | C19H21FN6O |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2-(2-fluorophenyl)acetamide |
| SMILES | Cc1ncn(-c2cc(NCCNC(=O)Cc3ccccc3F)ncn2)c1C |
| InChI | InChI=1S/C19H21FN6O/c1-13-14(2)26(12-25-13)18-10-17(23-11-24-18)21-7-8-22-19(27)9-15-5-3-4-6-16(15)20/h3-6,10-12H,7-9H2,1-2H3,(H,22,27)(H,21,23,24) |
| InChIKey | UUMVZGOYVOMTFA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|