C18H19ClN6O — CID 56922378
3-chloro-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide (PubChem CID 56922378) has the molecular formula C18H19ClN6O and a molecular weight of 370.84 g/mol. Its IUPAC name is 3-chloro-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide.
| Compound Name | 3-chloro-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 56922378 |
| Molecular Formula | C18H19ClN6O |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 3-chloro-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide |
| SMILES | Cc1ncn(-c2cc(NCCNC(=O)c3cccc(Cl)c3)ncn2)c1C |
| InChI | InChI=1S/C18H19ClN6O/c1-12-13(2)25(11-24-12)17-9-16(22-10-23-17)20-6-7-21-18(26)14-4-3-5-15(19)8-14/h3-5,8-11H,6-7H2,1-2H3,(H,21,26)(H,20,22,23) |
| InChIKey | HZYLLPSCCHXEJW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|