C17H22N8O2 — CID 122328709
N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-methoxy-1-methylpyrazole-4-carboxamide (PubChem CID 122328709) has the molecular formula C17H22N8O2 and a molecular weight of 370.42 g/mol. Its IUPAC name is N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-methoxy-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-methoxy-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 122328709 |
| Molecular Formula | C17H22N8O2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-methoxy-1-methylpyrazole-4-carboxamide |
| SMILES | COc1nn(C)cc1C(=O)NCCNc1cc(-n2cnc(C)c2C)ncn1 |
| InChI | InChI=1S/C17H22N8O2/c1-11-12(2)25(10-22-11)15-7-14(20-9-21-15)18-5-6-19-16(26)13-8-24(3)23-17(13)27-4/h7-10H,5-6H2,1-4H3,(H,19,26)(H,18,20,21) |
| InChIKey | SFDHHCOZBMWBHG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 111.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|