C16H16Cl2N6OS — CID 122328809
2,5-dichloro-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]thiophene-3-carboxamide (PubChem CID 122328809) has the molecular formula C16H16Cl2N6OS and a molecular weight of 411.32 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 122328809 |
| Molecular Formula | C16H16Cl2N6OS |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 2,5-dichloro-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]thiophene-3-carboxamide |
| SMILES | Cc1ncn(-c2cc(NCCNC(=O)c3cc(Cl)sc3Cl)ncn2)c1C |
| InChI | InChI=1S/C16H16Cl2N6OS/c1-9-10(2)24(8-23-9)14-6-13(21-7-22-14)19-3-4-20-16(25)11-5-12(17)26-15(11)18/h5-8H,3-4H2,1-2H3,(H,20,25)(H,19,21,22) |
| InChIKey | GPVWLCCPSSYZIO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|