C20H25N7O — CID 122328717
4-(dimethylamino)-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide (PubChem CID 122328717) has the molecular formula C20H25N7O and a molecular weight of 379.47 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide.
| Compound Name | 4-(dimethylamino)-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122328717 |
| Molecular Formula | C20H25N7O |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 4-(dimethylamino)-N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide |
| SMILES | Cc1ncn(-c2cc(NCCNC(=O)c3ccc(N(C)C)cc3)ncn2)c1C |
| InChI | InChI=1S/C20H25N7O/c1-14-15(2)27(13-25-14)19-11-18(23-12-24-19)21-9-10-22-20(28)16-5-7-17(8-6-16)26(3)4/h5-8,11-13H,9-10H2,1-4H3,(H,22,28)(H,21,23,24) |
| InChIKey | OBHSHEJJAVCILO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|