C20H23FN6O2 — CID 122328808
N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2-(2-fluorophenoxy)propanamide (PubChem CID 122328808) has the molecular formula C20H23FN6O2 and a molecular weight of 398.44 g/mol. Its IUPAC name is N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2-(2-fluorophenoxy)propanamide.
| Compound Name | N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2-(2-fluorophenoxy)propanamide |
|---|---|
| PubChem CID | 122328808 |
| Molecular Formula | C20H23FN6O2 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2-(2-fluorophenoxy)propanamide |
| SMILES | Cc1ncn(-c2cc(NCCNC(=O)C(C)Oc3ccccc3F)ncn2)c1C |
| InChI | InChI=1S/C20H23FN6O2/c1-13-14(2)27(12-26-13)19-10-18(24-11-25-19)22-8-9-23-20(28)15(3)29-17-7-5-4-6-16(17)21/h4-7,10-12,15H,8-9H2,1-3H3,(H,23,28)(H,22,24,25) |
| InChIKey | MAXBAJSMNBJSLL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|