C18H19F2N7O — CID 122328643
1-(2,5-difluorophenyl)-3-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea (PubChem CID 122328643) has the molecular formula C18H19F2N7O and a molecular weight of 387.39 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 122328643 |
| Molecular Formula | C18H19F2N7O |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea |
| SMILES | Cc1ncn(-c2cc(NCCNC(=O)Nc3cc(F)ccc3F)ncn2)c1C |
| InChI | InChI=1S/C18H19F2N7O/c1-11-12(2)27(10-25-11)17-8-16(23-9-24-17)21-5-6-22-18(28)26-15-7-13(19)3-4-14(15)20/h3-4,7-10H,5-6H2,1-2H3,(H,21,23,24)(H2,22,26,28) |
| InChIKey | GZQYBJOPNRPZRL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|