C19H20F2N6O — CID 56920464
N-[2-[[6-(4,5-dimethylimidazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-2,4-difluorobenzamide (PubChem CID 56920464) has the molecular formula C19H20F2N6O and a molecular weight of 386.41 g/mol. Its IUPAC name is N-[2-[[6-(4,5-dimethylimidazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-[[6-(4,5-dimethylimidazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 56920464 |
| Molecular Formula | C19H20F2N6O |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[2-[[6-(4,5-dimethylimidazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-2,4-difluorobenzamide |
| SMILES | Cc1nc(NCCNC(=O)c2ccc(F)cc2F)cc(-n2cnc(C)c2C)n1 |
| InChI | InChI=1S/C19H20F2N6O/c1-11-12(2)27(10-24-11)18-9-17(25-13(3)26-18)22-6-7-23-19(28)15-5-4-14(20)8-16(15)21/h4-5,8-10H,6-7H2,1-3H3,(H,23,28)(H,22,25,26) |
| InChIKey | UWHFYUINFRYCAO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|