C20H26N6O3S — CID 122328631
N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-4-methoxy-2,3-dimethylbenzenesulfonamide (PubChem CID 122328631) has the molecular formula C20H26N6O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-4-methoxy-2,3-dimethylbenzenesulfonamide.
| Compound Name | N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-4-methoxy-2,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 122328631 |
| Molecular Formula | C20H26N6O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | N-[2-[[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-4-methoxy-2,3-dimethylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNc2cc(-n3cnc(C)c3C)ncn2)c(C)c1C |
| InChI | InChI=1S/C20H26N6O3S/c1-13-14(2)18(7-6-17(13)29-5)30(27,28)25-9-8-21-19-10-20(23-11-22-19)26-12-24-15(3)16(26)4/h6-7,10-12,25H,8-9H2,1-5H3,(H,21,22,23) |
| InChIKey | VONVBGYSQXJTPF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|