C18H18F2N6O2S — CID 122314431
1-(2,5-difluorophenyl)-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]methanesulfonamide (PubChem CID 122314431) has the molecular formula C18H18F2N6O2S and a molecular weight of 420.45 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]methanesulfonamide.
| Compound Name | 1-(2,5-difluorophenyl)-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 122314431 |
| Molecular Formula | C18H18F2N6O2S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 1-(2,5-difluorophenyl)-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1cc(F)ccc1F)NCCNc1cc(Nc2ccccn2)ncn1 |
| InChI | InChI=1S/C18H18F2N6O2S/c19-14-4-5-15(20)13(9-14)11-29(27,28)25-8-7-22-17-10-18(24-12-23-17)26-16-3-1-2-6-21-16/h1-6,9-10,12,25H,7-8,11H2,(H2,21,22,23,24,26) |
| InChIKey | OKJAQPNSNBSYQM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|