C17H16F2N6O2S — CID 122314427
3,5-difluoro-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide (PubChem CID 122314427) has the molecular formula C17H16F2N6O2S and a molecular weight of 406.42 g/mol. Its IUPAC name is 3,5-difluoro-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 3,5-difluoro-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122314427 |
| Molecular Formula | C17H16F2N6O2S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 3,5-difluoro-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1cc(Nc2ccccn2)ncn1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H16F2N6O2S/c18-12-7-13(19)9-14(8-12)28(26,27)24-6-5-21-16-10-17(23-11-22-16)25-15-3-1-2-4-20-15/h1-4,7-11,24H,5-6H2,(H2,20,21,22,23,25) |
| InChIKey | SYFOMJMIPHZHFO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|