C18H23N7O4S — CID 122314407
2-(2,6-dioxopiperidin-1-yl)-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]ethanesulfonamide (PubChem CID 122314407) has the molecular formula C18H23N7O4S and a molecular weight of 433.49 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-1-yl)-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]ethanesulfonamide.
| Compound Name | 2-(2,6-dioxopiperidin-1-yl)-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 122314407 |
| Molecular Formula | C18H23N7O4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-1-yl)-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]ethanesulfonamide |
| SMILES | O=C1CCCC(=O)N1CCS(=O)(=O)NCCNc1cc(Nc2ccccn2)ncn1 |
| InChI | InChI=1S/C18H23N7O4S/c26-17-5-3-6-18(27)25(17)10-11-30(28,29)23-9-8-20-15-12-16(22-13-21-15)24-14-4-1-2-7-19-14/h1-2,4,7,12-13,23H,3,5-6,8-11H2,(H2,19,20,21,22,24) |
| InChIKey | LAPXZZLUGMLUES-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|