C20H18N6O2 — CID 122314281
N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-1-benzofuran-2-carboxamide (PubChem CID 122314281) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 122314281 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCNc1cc(Nc2ccccn2)ncn1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H18N6O2/c27-20(16-11-14-5-1-2-6-15(14)28-16)23-10-9-22-18-12-19(25-13-24-18)26-17-7-3-4-8-21-17/h1-8,11-13H,9-10H2,(H,23,27)(H2,21,22,24,25,26) |
| InChIKey | QSPOHUFPTPVWKC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|