C25H24N6O — CID 122314152
2,2-diphenyl-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 122314152) has the molecular formula C25H24N6O and a molecular weight of 424.51 g/mol. Its IUPAC name is 2,2-diphenyl-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | 2,2-diphenyl-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122314152 |
| Molecular Formula | C25H24N6O |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2,2-diphenyl-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | O=C(NCCNc1cc(Nc2ccccn2)ncn1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H24N6O/c32-25(24(19-9-3-1-4-10-19)20-11-5-2-6-12-20)28-16-15-27-22-17-23(30-18-29-22)31-21-13-7-8-14-26-21/h1-14,17-18,24H,15-16H2,(H,28,32)(H2,26,27,29,30,31) |
| InChIKey | LUWZTDKOHPCLBF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|