C20H18N8O — CID 122314374
N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]quinoxaline-6-carboxamide (PubChem CID 122314374) has the molecular formula C20H18N8O and a molecular weight of 386.42 g/mol. Its IUPAC name is N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]quinoxaline-6-carboxamide.
| Compound Name | N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 122314374 |
| Molecular Formula | C20H18N8O |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]quinoxaline-6-carboxamide |
| SMILES | O=C(NCCNc1cc(Nc2ccccn2)ncn1)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C20H18N8O/c29-20(14-4-5-15-16(11-14)22-8-7-21-15)25-10-9-24-18-12-19(27-13-26-18)28-17-3-1-2-6-23-17/h1-8,11-13H,9-10H2,(H,25,29)(H2,23,24,26,27,28) |
| InChIKey | WSGXSZGNOLGTOF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|