C23H28N6O — CID 122314519
4-tert-butyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide (PubChem CID 122314519) has the molecular formula C23H28N6O and a molecular weight of 404.52 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122314519 |
| Molecular Formula | C23H28N6O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 4-tert-butyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide |
| SMILES | Cc1ccnc(Nc2cc(NCCNC(=O)c3ccc(C(C)(C)C)cc3)ncn2)c1 |
| InChI | InChI=1S/C23H28N6O/c1-16-9-10-24-20(13-16)29-21-14-19(27-15-28-21)25-11-12-26-22(30)17-5-7-18(8-6-17)23(2,3)4/h5-10,13-15H,11-12H2,1-4H3,(H,26,30)(H2,24,25,27,28,29) |
| InChIKey | SVOUPAVNBXOTNW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|