C21H19F6N7O — CID 122314643
1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]urea (PubChem CID 122314643) has the molecular formula C21H19F6N7O and a molecular weight of 499.42 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 122314643 |
| Molecular Formula | C21H19F6N7O |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]urea |
| SMILES | Cc1ccnc(Nc2cc(NCCNC(=O)Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)ncn2)c1 |
| InChI | InChI=1S/C21H19F6N7O/c1-12-2-3-28-17(6-12)34-18-10-16(31-11-32-18)29-4-5-30-19(35)33-15-8-13(20(22,23)24)7-14(9-15)21(25,26)27/h2-3,6-11H,4-5H2,1H3,(H2,30,33,35)(H2,28,29,31,32,34) |
| InChIKey | STKWFRIQMRZWQG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|