C21H25N7O3 — CID 122314896
1-(2,3-dimethoxyphenyl)-3-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]urea (PubChem CID 122314896) has the molecular formula C21H25N7O3 and a molecular weight of 423.48 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-3-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]urea.
| Compound Name | 1-(2,3-dimethoxyphenyl)-3-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 122314896 |
| Molecular Formula | C21H25N7O3 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-3-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]urea |
| SMILES | COc1cccc(NC(=O)NCCNc2cc(Nc3cc(C)ccn3)ncn2)c1OC |
| InChI | InChI=1S/C21H25N7O3/c1-14-7-8-22-18(11-14)28-19-12-17(25-13-26-19)23-9-10-24-21(29)27-15-5-4-6-16(30-2)20(15)31-3/h4-8,11-13H,9-10H2,1-3H3,(H2,24,27,29)(H2,22,23,25,26,28) |
| InChIKey | NJGKCMSNFVQWBS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|