C20H20F3N7O — CID 122314584
1-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 122314584) has the molecular formula C20H20F3N7O and a molecular weight of 431.42 g/mol. Its IUPAC name is 1-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 122314584 |
| Molecular Formula | C20H20F3N7O |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 1-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccnc(Nc2cc(NCCNC(=O)Nc3cccc(C(F)(F)F)c3)ncn2)c1 |
| InChI | InChI=1S/C20H20F3N7O/c1-13-5-6-24-17(9-13)30-18-11-16(27-12-28-18)25-7-8-26-19(31)29-15-4-2-3-14(10-15)20(21,22)23/h2-6,9-12H,7-8H2,1H3,(H2,26,29,31)(H2,24,25,27,28,30) |
| InChIKey | KCXULFOEKZLCOL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|