C22H23F3N6O — CID 122315627
N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 122315627) has the molecular formula C22H23F3N6O and a molecular weight of 444.46 g/mol. Its IUPAC name is N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 122315627 |
| Molecular Formula | C22H23F3N6O |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccnc(Nc2cc(NCCNC(=O)Cc3cccc(C(F)(F)F)c3)nc(C)n2)c1 |
| InChI | InChI=1S/C22H23F3N6O/c1-14-6-7-26-18(10-14)31-20-13-19(29-15(2)30-20)27-8-9-28-21(32)12-16-4-3-5-17(11-16)22(23,24)25/h3-7,10-11,13H,8-9,12H2,1-2H3,(H,28,32)(H2,26,27,29,30,31) |
| InChIKey | MEVUWLVMEQYZEH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|