C24H30N6O2 — CID 122315371
4-butoxy-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide (PubChem CID 122315371) has the molecular formula C24H30N6O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-butoxy-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide.
| Compound Name | 4-butoxy-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122315371 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 4-butoxy-N-[2-[[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCCNc2cc(Nc3cc(C)ccn3)nc(C)n2)cc1 |
| InChI | InChI=1S/C24H30N6O2/c1-4-5-14-32-20-8-6-19(7-9-20)24(31)27-13-12-26-22-16-23(29-18(3)28-22)30-21-15-17(2)10-11-25-21/h6-11,15-16H,4-5,12-14H2,1-3H3,(H,27,31)(H2,25,26,28,29,30) |
| InChIKey | VNEOQBLGIVQYPP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|