C19H19ClFN7O — CID 42111663
1-(3-chloro-4-fluorophenyl)-3-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]urea (PubChem CID 42111663) has the molecular formula C19H19ClFN7O and a molecular weight of 415.86 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 42111663 |
| Molecular Formula | C19H19ClFN7O |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]urea |
| SMILES | Cc1ccnc(Nc2ccc(NCCNC(=O)Nc3ccc(F)c(Cl)c3)nn2)c1 |
| InChI | InChI=1S/C19H19ClFN7O/c1-12-6-7-22-18(10-12)26-17-5-4-16(27-28-17)23-8-9-24-19(29)25-13-2-3-15(21)14(20)11-13/h2-7,10-11H,8-9H2,1H3,(H,23,27)(H,22,26,28)(H2,24,25,29) |
| InChIKey | HFNZPOPVSCNXQT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|