C18H20ClFN4O2 — CID 50959320
N'-(3-chloro-4-fluorophenyl)-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]butanediamide (PubChem CID 50959320) has the molecular formula C18H20ClFN4O2 and a molecular weight of 378.84 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]butanediamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]butanediamide |
|---|---|
| PubChem CID | 50959320 |
| Molecular Formula | C18H20ClFN4O2 |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]butanediamide |
| SMILES | Cc1ccnc(NCCNC(=O)CCC(=O)Nc2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H20ClFN4O2/c1-12-6-7-21-16(10-12)22-8-9-23-17(25)4-5-18(26)24-13-2-3-15(20)14(19)11-13/h2-3,6-7,10-11H,4-5,8-9H2,1H3,(H,21,22)(H,23,25)(H,24,26) |
| InChIKey | SIWATNXIBIMZTB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|