C17H18ClFN2O — CID 109035868
N-(3-chloro-4-fluorophenyl)-3-(2,6-dimethylanilino)propanamide (PubChem CID 109035868) has the molecular formula C17H18ClFN2O and a molecular weight of 320.80 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-(2,6-dimethylanilino)propanamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-(2,6-dimethylanilino)propanamide |
|---|---|
| PubChem CID | 109035868 |
| Molecular Formula | C17H18ClFN2O |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-(2,6-dimethylanilino)propanamide |
| SMILES | Cc1cccc(C)c1NCCC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H18ClFN2O/c1-11-4-3-5-12(2)17(11)20-9-8-16(22)21-13-6-7-15(19)14(18)10-13/h3-7,10,20H,8-9H2,1-2H3,(H,21,22) |
| InChIKey | OUYMJKSBWPNLOG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |