C17H17ClF2N2O — CID 109038951
3-(2-chloro-4,6-dimethylanilino)-N-(3,4-difluorophenyl)propanamide (PubChem CID 109038951) has the molecular formula C17H17ClF2N2O and a molecular weight of 338.79 g/mol. Its IUPAC name is 3-(2-chloro-4,6-dimethylanilino)-N-(3,4-difluorophenyl)propanamide.
| Compound Name | 3-(2-chloro-4,6-dimethylanilino)-N-(3,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 109038951 |
| Molecular Formula | C17H17ClF2N2O |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 3-(2-chloro-4,6-dimethylanilino)-N-(3,4-difluorophenyl)propanamide |
| SMILES | Cc1cc(C)c(NCCC(=O)Nc2ccc(F)c(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C17H17ClF2N2O/c1-10-7-11(2)17(13(18)8-10)21-6-5-16(23)22-12-3-4-14(19)15(20)9-12/h3-4,7-9,21H,5-6H2,1-2H3,(H,22,23) |
| InChIKey | CKSUWKFGONVZPU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |