C19H24ClN3O — CID 109038931
3-(2-chloro-4,6-dimethylanilino)-N-[4-(dimethylamino)phenyl]propanamide (PubChem CID 109038931) has the molecular formula C19H24ClN3O and a molecular weight of 345.87 g/mol. Its IUPAC name is 3-(2-chloro-4,6-dimethylanilino)-N-[4-(dimethylamino)phenyl]propanamide.
| Compound Name | 3-(2-chloro-4,6-dimethylanilino)-N-[4-(dimethylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 109038931 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-(2-chloro-4,6-dimethylanilino)-N-[4-(dimethylamino)phenyl]propanamide |
| SMILES | Cc1cc(C)c(NCCC(=O)Nc2ccc(N(C)C)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H24ClN3O/c1-13-11-14(2)19(17(20)12-13)21-10-9-18(24)22-15-5-7-16(8-6-15)23(3)4/h5-8,11-12,21H,9-10H2,1-4H3,(H,22,24) |
| InChIKey | VBVIVYNHHWSTIE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|