C21H24ClN3O2 — CID 108982874
1-N'-(2-chloro-4,6-dimethylphenyl)-1-N-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 108982874) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is 1-N'-(2-chloro-4,6-dimethylphenyl)-1-N-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(2-chloro-4,6-dimethylphenyl)-1-N-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108982874 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-N'-(2-chloro-4,6-dimethylphenyl)-1-N-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1cc(C)c(NC(=O)C2(C(=O)Nc3ccc(N(C)C)cc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C21H24ClN3O2/c1-13-11-14(2)18(17(22)12-13)24-20(27)21(9-10-21)19(26)23-15-5-7-16(8-6-15)25(3)4/h5-8,11-12H,9-10H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | QNMPKWLIBVHAOJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|