C22H23ClN4O — CID 109244980
N-(2-chloro-4,6-dimethylphenyl)-5-[4-(dimethylamino)anilino]pyridine-3-carboxamide (PubChem CID 109244980) has the molecular formula C22H23ClN4O and a molecular weight of 394.91 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-5-[4-(dimethylamino)anilino]pyridine-3-carboxamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-5-[4-(dimethylamino)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109244980 |
| Molecular Formula | C22H23ClN4O |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-5-[4-(dimethylamino)anilino]pyridine-3-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2cncc(Nc3ccc(N(C)C)cc3)c2)c(Cl)c1 |
| InChI | InChI=1S/C22H23ClN4O/c1-14-9-15(2)21(20(23)10-14)26-22(28)16-11-18(13-24-12-16)25-17-5-7-19(8-6-17)27(3)4/h5-13,25H,1-4H3,(H,26,28) |
| InChIKey | COVZVHCMJCRVOI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|