C19H24ClN3O — CID 109240170
N-(2-chloro-4,6-dimethylphenyl)-5-(pentylamino)pyridine-3-carboxamide (PubChem CID 109240170) has the molecular formula C19H24ClN3O and a molecular weight of 345.87 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-5-(pentylamino)pyridine-3-carboxamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-5-(pentylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109240170 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-5-(pentylamino)pyridine-3-carboxamide |
| SMILES | CCCCCNc1cncc(C(=O)Nc2c(C)cc(C)cc2Cl)c1 |
| InChI | InChI=1S/C19H24ClN3O/c1-4-5-6-7-22-16-10-15(11-21-12-16)19(24)23-18-14(3)8-13(2)9-17(18)20/h8-12,22H,4-7H2,1-3H3,(H,23,24) |
| InChIKey | KGACWDTVDQMPFG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|