C21H25N3O2 — CID 108981425
1-N-[4-(dimethylamino)phenyl]-1-N'-(3,4-dimethylphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108981425) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-N-[4-(dimethylamino)phenyl]-1-N'-(3,4-dimethylphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[4-(dimethylamino)phenyl]-1-N'-(3,4-dimethylphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108981425 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-N-[4-(dimethylamino)phenyl]-1-N'-(3,4-dimethylphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)C2(C(=O)Nc3ccc(N(C)C)cc3)CC2)cc1C |
| InChI | InChI=1S/C21H25N3O2/c1-14-5-6-17(13-15(14)2)23-20(26)21(11-12-21)19(25)22-16-7-9-18(10-8-16)24(3)4/h5-10,13H,11-12H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | GSWIPOSMNFOORV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|