C23H28N2O2 — CID 108981391
1-N-(4-tert-butylphenyl)-1-N'-(3,4-dimethylphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108981391) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-N-(4-tert-butylphenyl)-1-N'-(3,4-dimethylphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(4-tert-butylphenyl)-1-N'-(3,4-dimethylphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108981391 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-N-(4-tert-butylphenyl)-1-N'-(3,4-dimethylphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)C2(C(=O)Nc3ccc(C(C)(C)C)cc3)CC2)cc1C |
| InChI | InChI=1S/C23H28N2O2/c1-15-6-9-19(14-16(15)2)25-21(27)23(12-13-23)20(26)24-18-10-7-17(8-11-18)22(3,4)5/h6-11,14H,12-13H2,1-5H3,(H,24,26)(H,25,27) |
| InChIKey | JQNXDQVCAKKNPV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|