C20H22ClN3O2 — CID 108982657
1-N'-(3-chloro-2-methylphenyl)-1-N-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 108982657) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 1-N'-(3-chloro-2-methylphenyl)-1-N-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(3-chloro-2-methylphenyl)-1-N-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108982657 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-N'-(3-chloro-2-methylphenyl)-1-N-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C1(C(=O)Nc2ccc(N(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H22ClN3O2/c1-13-16(21)5-4-6-17(13)23-19(26)20(11-12-20)18(25)22-14-7-9-15(10-8-14)24(2)3/h4-10H,11-12H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | WGLURNSIPSRESU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|