C21H26ClN3O — CID 109038932
3-(2-chloro-4,6-dimethylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide (PubChem CID 109038932) has the molecular formula C21H26ClN3O and a molecular weight of 371.91 g/mol. Its IUPAC name is 3-(2-chloro-4,6-dimethylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide.
| Compound Name | 3-(2-chloro-4,6-dimethylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 109038932 |
| Molecular Formula | C21H26ClN3O |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 3-(2-chloro-4,6-dimethylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide |
| SMILES | Cc1cc(C)c(NCCC(=O)Nc2ccc(N3CCCC3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C21H26ClN3O/c1-15-13-16(2)21(19(22)14-15)23-10-9-20(26)24-17-5-7-18(8-6-17)25-11-3-4-12-25/h5-8,13-14,23H,3-4,9-12H2,1-2H3,(H,24,26) |
| InChIKey | BWBYFUXNVOSGQO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|