C22H29N3O — CID 37221892
2-(4-piperidin-1-ylanilino)-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 37221892) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-(4-piperidin-1-ylanilino)-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-(4-piperidin-1-ylanilino)-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 37221892 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 2-(4-piperidin-1-ylanilino)-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CNc2ccc(N3CCCCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C22H29N3O/c1-16-13-17(2)22(18(3)14-16)24-21(26)15-23-19-7-9-20(10-8-19)25-11-5-4-6-12-25/h7-10,13-14,23H,4-6,11-12,15H2,1-3H3,(H,24,26) |
| InChIKey | KEJCOGDRJJLNMI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|