C26H26N6O — CID 121064588
N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-2,2-diphenylacetamide (PubChem CID 121064588) has the molecular formula C26H26N6O and a molecular weight of 438.54 g/mol. Its IUPAC name is N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 121064588 |
| Molecular Formula | C26H26N6O |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-2,2-diphenylacetamide |
| SMILES | Cc1ccnc(Nc2ccc(NCCNC(=O)C(c3ccccc3)c3ccccc3)nn2)c1 |
| InChI | InChI=1S/C26H26N6O/c1-19-14-15-27-24(18-19)30-23-13-12-22(31-32-23)28-16-17-29-26(33)25(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-15,18,25H,16-17H2,1H3,(H,28,31)(H,29,33)(H,27,30,32) |
| InChIKey | BPMIAFJXNDLFQJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|