C24H24N6O2S — CID 121064562
N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-4-phenylbenzenesulfonamide (PubChem CID 121064562) has the molecular formula C24H24N6O2S and a molecular weight of 460.56 g/mol. Its IUPAC name is N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 121064562 |
| Molecular Formula | C24H24N6O2S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-4-phenylbenzenesulfonamide |
| SMILES | Cc1ccnc(Nc2ccc(NCCNS(=O)(=O)c3ccc(-c4ccccc4)cc3)nn2)c1 |
| InChI | InChI=1S/C24H24N6O2S/c1-18-13-14-25-24(17-18)28-23-12-11-22(29-30-23)26-15-16-27-33(31,32)21-9-7-20(8-10-21)19-5-3-2-4-6-19/h2-14,17,27H,15-16H2,1H3,(H,26,29)(H,25,28,30) |
| InChIKey | OSYJROBPHZJZKR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|