C22H21N5O2S — CID 122307342
4-phenyl-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide (PubChem CID 122307342) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is 4-phenyl-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-phenyl-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122307342 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 4-phenyl-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1ccc(-n2cccc2)nn1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N5O2S/c28-30(29,20-10-8-19(9-11-20)18-6-2-1-3-7-18)24-15-14-23-21-12-13-22(26-25-21)27-16-4-5-17-27/h1-13,16-17,24H,14-15H2,(H,23,25) |
| InChIKey | BDYVJXKNLJFCEW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|